C26H46N2O4 — CID 70594525
bis(2,2,6,6-tetramethylpiperidin-4-yl) cyclohexane-1,2-dicarboxylate (PubChem CID 70594525) has the molecular formula C26H46N2O4 and a molecular weight of 450.66 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) cyclohexane-1,2-dicarboxylate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 70594525 |
| Molecular Formula | C26H46N2O4 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) cyclohexane-1,2-dicarboxylate |
| SMILES | CC1(C)CC(OC(=O)C2CCCCC2C(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C26H46N2O4/c1-23(2)13-17(14-24(3,4)27-23)31-21(29)19-11-9-10-12-20(19)22(30)32-18-15-25(5,6)28-26(7,8)16-18/h17-20,27-28H,9-16H2,1-8H3 |
| InChIKey | ORIYJQLXCYSOSO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |