C26H31NO5 — CID 70594794
ethyl (1S,14S)-12-(furan-2-carbonyl)-5-methoxy-1,10,14-trimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-triene-12-carboxylate (PubChem CID 70594794) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is ethyl (1S,14S)-12-(furan-2-carbonyl)-5-methoxy-1,10,14-trimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-triene-12-carboxylate.
| Compound Name | ethyl (1S,14S)-12-(furan-2-carbonyl)-5-methoxy-1,10,14-trimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-triene-12-carboxylate |
|---|---|
| PubChem CID | 70594794 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | ethyl (1S,14S)-12-(furan-2-carbonyl)-5-methoxy-1,10,14-trimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-triene-12-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)c2ccco2)C[C@]2(C)C3Cc4cc(OC)ccc4[C@]2(C)CC1N3C |
| InChI | InChI=1S/C26H31NO5/c1-6-31-23(29)26(22(28)19-8-7-11-32-19)15-25(3)20-13-16-12-17(30-5)9-10-18(16)24(25,2)14-21(26)27(20)4/h7-12,20-21H,6,13-15H2,1-5H3/t20?,21?,24-,25+,26?/m0/s1 |
| InChIKey | PKVBIWSDJVCVCQ-QWOZJOBSSA-N |
| XLogP | 4.02 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|