C28H24Cl2N2O4 — CID 70594815
benzhydryl 3,4-dichloro-3-methyl-2-[(1R,5S)-7-oxo-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]butanoate (PubChem CID 70594815) has the molecular formula C28H24Cl2N2O4 and a molecular weight of 523.42 g/mol. Its IUPAC name is benzhydryl 3,4-dichloro-3-methyl-2-[(1R,5S)-7-oxo-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]butanoate.
| Compound Name | benzhydryl 3,4-dichloro-3-methyl-2-[(1R,5S)-7-oxo-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]butanoate |
|---|---|
| PubChem CID | 70594815 |
| Molecular Formula | C28H24Cl2N2O4 |
| Molecular Weight | 523.42 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | benzhydryl 3,4-dichloro-3-methyl-2-[(1R,5S)-7-oxo-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]butanoate |
| SMILES | CC(Cl)(CCl)C(C(=O)OC(c1ccccc1)c1ccccc1)N1C(=O)[C@@H]2N=C(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C28H24Cl2N2O4/c1-28(30,17-29)23(32-25(33)21-26(32)36-24(31-21)20-15-9-4-10-16-20)27(34)35-22(18-11-5-2-6-12-18)19-13-7-3-8-14-19/h2-16,21-23,26H,17H2,1H3/t21-,23?,26-,28?/m0/s1 |
| InChIKey | CTGLKRIEOOWSHN-BKPIVTFFSA-N |
| XLogP | 4.94 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|