C23H28BrN — CID 70594887
1-benzhydrylidene-3,5,6,7,8,8a-hexahydro-2H-indolizine;bromoethane (PubChem CID 70594887) has the molecular formula C23H28BrN and a molecular weight of 398.39 g/mol. Its IUPAC name is 1-benzhydrylidene-3,5,6,7,8,8a-hexahydro-2H-indolizine;bromoethane.
| Compound Name | 1-benzhydrylidene-3,5,6,7,8,8a-hexahydro-2H-indolizine;bromoethane |
|---|---|
| PubChem CID | 70594887 |
| Molecular Formula | C23H28BrN |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 1-benzhydrylidene-3,5,6,7,8,8a-hexahydro-2H-indolizine;bromoethane |
| SMILES | CCBr.c1ccc(C(=C2CCN3CCCCC23)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23N.C2H5Br/c1-3-9-17(10-4-1)21(18-11-5-2-6-12-18)19-14-16-22-15-8-7-13-20(19)22;1-2-3/h1-6,9-12,20H,7-8,13-16H2;2H2,1H3 |
| InChIKey | UMZOTETUQVFUIS-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|