C31H50O2 — CID 70595061
4,5-bis(3,7-dimethylocta-2,6-dienyl)-3,6-dimethoxy-1,2,5-trimethylcyclohexa-1,3-diene (PubChem CID 70595061) has the molecular formula C31H50O2 and a molecular weight of 454.74 g/mol. Its IUPAC name is 4,5-bis(3,7-dimethylocta-2,6-dienyl)-3,6-dimethoxy-1,2,5-trimethylcyclohexa-1,3-diene.
| Compound Name | 4,5-bis(3,7-dimethylocta-2,6-dienyl)-3,6-dimethoxy-1,2,5-trimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 70595061 |
| Molecular Formula | C31H50O2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | 4,5-bis(3,7-dimethylocta-2,6-dienyl)-3,6-dimethoxy-1,2,5-trimethylcyclohexa-1,3-diene |
| SMILES | COC1=C(CC=C(C)CCC=C(C)C)C(C)(CC=C(C)CCC=C(C)C)C(OC)C(C)=C1C |
| InChI | InChI=1S/C31H50O2/c1-22(2)14-12-16-24(5)18-19-28-29(32-10)26(7)27(8)30(33-11)31(28,9)21-20-25(6)17-13-15-23(3)4/h14-15,18,20,30H,12-13,16-17,19,21H2,1-11H3 |
| InChIKey | FOPTUAIPXXEMAV-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|