C34H43NO — CID 70595115
(1R,4aR,4bR)-N,N-dibenzyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxamide (PubChem CID 70595115) has the molecular formula C34H43NO and a molecular weight of 481.72 g/mol. Its IUPAC name is (1R,4aR,4bR)-N,N-dibenzyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxamide.
| Compound Name | (1R,4aR,4bR)-N,N-dibenzyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 70595115 |
| Molecular Formula | C34H43NO |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | (1R,4aR,4bR)-N,N-dibenzyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxamide |
| SMILES | CC(C)C1=CC2=CCC3[C@](C)(C(=O)N(Cc4ccccc4)Cc4ccccc4)CCC[C@]3(C)[C@H]2CC1 |
| InChI | InChI=1S/C34H43NO/c1-25(2)28-16-18-30-29(22-28)17-19-31-33(30,3)20-11-21-34(31,4)32(36)35(23-26-12-7-5-8-13-26)24-27-14-9-6-10-15-27/h5-10,12-15,17,22,25,30-31H,11,16,18-21,23-24H2,1-4H3/t30-,31?,33+,34+/m0/s1 |
| InChIKey | HYEYCCVFUBIUKI-METHNVCBSA-N |
| XLogP | 8.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |