About 1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine
1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine (PubChem CID 70595224) has the molecular formula C23H26FN
and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine.
Molecular Properties
| Compound Name | 1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine |
| PubChem CID | 70595224 |
| Molecular Formula | C23H26FN |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine |
| SMILES | CCC(C)c1ccc(-c2ccc(F)cc2)cc1.NCc1ccccc1 |
| InChI | InChI=1S/C16H17F.C7H9N/c1-3-12(2)13-4-6-14(7-5-13)15-8-10-16(17)11-9-15;8-6-7-4-2-1-3-5-7/h4-12H,3H2,1-2H3;1-5H,6,8H2 |
| InChIKey | UIMBULWOEVNSMN-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine?
The IUPAC name of 1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine (CID 70595224) is 1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine.
What is the SMILES notation for 1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine?
The canonical SMILES for 1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine is CCC(C)c1ccc(-c2ccc(F)cc2)cc1.NCc1ccccc1.
What is the InChIKey of 1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine?
The InChIKey is UIMBULWOEVNSMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F.C7H9N/c1-3-12(2)13-4-6-14(7-5-13)15-8-10-16(17)11-9-15;8-6-7-4-2-1-3-5-7/h4-12H,3H2,1-2H3;1-5H,6,8H2.
What are the key properties of 1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine?
1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine has a molecular weight of 335.47 g/mol, XLogP of 6.15, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-4-(4-fluorophenyl)benzene;phenylmethanamine is sourced from PubChem (CID 70595224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).