C6H9NO2 — CID 7059534
1,2,3,6-tetrahydropyridin-1-ium-4-carboxylate (PubChem CID 7059534) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 1,2,3,6-tetrahydropyridin-1-ium-4-carboxylate.
| Compound Name | 1,2,3,6-tetrahydropyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 7059534 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 1,2,3,6-tetrahydropyridin-1-ium-4-carboxylate |
| SMILES | O=C([O-])C1=CC[NH2+]CC1 |
| InChI | InChI=1S/C6H9NO2/c8-6(9)5-1-3-7-4-2-5/h1,7H,2-4H2,(H,8,9) |
| InChIKey | KRVDMABBKYMBHG-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |