C23H26N2O6 — CID 70595549
but-2-enedioic acid;12-methoxy-17-methyl-8-oxa-1,17-diazatetracyclo[13.5.0.02,7.09,14]icosa-2,4,6,9(14),10,12-hexaene (PubChem CID 70595549) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is but-2-enedioic acid;12-methoxy-17-methyl-8-oxa-1,17-diazatetracyclo[13.5.0.02,7.09,14]icosa-2,4,6,9(14),10,12-hexaene.
| Compound Name | but-2-enedioic acid;12-methoxy-17-methyl-8-oxa-1,17-diazatetracyclo[13.5.0.02,7.09,14]icosa-2,4,6,9(14),10,12-hexaene |
|---|---|
| PubChem CID | 70595549 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | but-2-enedioic acid;12-methoxy-17-methyl-8-oxa-1,17-diazatetracyclo[13.5.0.02,7.09,14]icosa-2,4,6,9(14),10,12-hexaene |
| SMILES | COc1ccc2c(c1)C1CN(C)CCCN1c1ccccc1O2.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C19H22N2O2.C4H4O4/c1-20-10-5-11-21-16-6-3-4-7-19(16)23-18-9-8-14(22-2)12-15(18)17(21)13-20;5-3(6)1-2-4(7)8/h3-4,6-9,12,17H,5,10-11,13H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | XEKLPMIZTSJFKL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|