C20H21NO4 — CID 70595979
(2S)-1-(2-methyl-4-naphthalen-2-yl-3,4-dioxobutyl)pyrrolidine-2-carboxylic acid (PubChem CID 70595979) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (2S)-1-(2-methyl-4-naphthalen-2-yl-3,4-dioxobutyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(2-methyl-4-naphthalen-2-yl-3,4-dioxobutyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70595979 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (2S)-1-(2-methyl-4-naphthalen-2-yl-3,4-dioxobutyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(CN1CCC[C@H]1C(=O)O)C(=O)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H21NO4/c1-13(12-21-10-4-7-17(21)20(24)25)18(22)19(23)16-9-8-14-5-2-3-6-15(14)11-16/h2-3,5-6,8-9,11,13,17H,4,7,10,12H2,1H3,(H,24,25)/t13?,17-/m0/s1 |
| InChIKey | QZSFWEUUDOLOEM-RUINGEJQSA-N |
| XLogP | 2.78 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|