About (4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one
(4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one (PubChem CID 7059600) has the molecular formula C7H6O4
and a molecular weight of 154.12 g/mol. Its IUPAC name is (4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one.
Molecular Properties
| Compound Name | (4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one |
| PubChem CID | 7059600 |
| Molecular Formula | C7H6O4 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | (4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one |
| SMILES | O=C1C=C2C(=CCO[C@@H]2O)O1 |
| InChI | InChI=1S/C7H6O4/c8-6-3-4-5(11-6)1-2-10-7(4)9/h1,3,7,9H,2H2/t7-/m0/s1 |
| InChIKey | ZRWPUFFVAOMMNM-ZETCQYMHSA-N |
| XLogP | -0.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one?
The IUPAC name of (4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one (CID 7059600) is (4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one.
What is the SMILES notation for (4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one?
The canonical SMILES for (4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one is O=C1C=C2C(=CCO[C@@H]2O)O1.
What is the InChIKey of (4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one?
The InChIKey is ZRWPUFFVAOMMNM-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H6O4/c8-6-3-4-5(11-6)1-2-10-7(4)9/h1,3,7,9H,2H2/t7-/m0/s1.
What are the key properties of (4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one?
(4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one has a molecular weight of 154.12 g/mol, XLogP of -0.30, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-hydroxy-4,6-dihydrofuro[3,2-c]pyran-2-one is sourced from PubChem (CID 7059600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).