C29H50O6 — CID 70596192
ethyl 7-[(8R,9R)-8-[2-(2-octan-2-yl-1,3-dioxolan-2-yl)ethenyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate (PubChem CID 70596192) has the molecular formula C29H50O6 and a molecular weight of 494.71 g/mol. Its IUPAC name is ethyl 7-[(8R,9R)-8-[2-(2-octan-2-yl-1,3-dioxolan-2-yl)ethenyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate.
| Compound Name | ethyl 7-[(8R,9R)-8-[2-(2-octan-2-yl-1,3-dioxolan-2-yl)ethenyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate |
|---|---|
| PubChem CID | 70596192 |
| Molecular Formula | C29H50O6 |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | ethyl 7-[(8R,9R)-8-[2-(2-octan-2-yl-1,3-dioxolan-2-yl)ethenyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate |
| SMILES | CCCCCCC(C)C1(C=C[C@H]2CCC3(OCCO3)[C@@H]2CCCCCCC(=O)OCC)OCCO1 |
| InChI | InChI=1S/C29H50O6/c1-4-6-7-10-13-24(3)28(32-20-21-33-28)18-16-25-17-19-29(34-22-23-35-29)26(25)14-11-8-9-12-15-27(30)31-5-2/h16,18,24-26H,4-15,17,19-23H2,1-3H3/t24?,25-,26+/m0/s1 |
| InChIKey | QWCKCKBCFHMIMS-XBCLTQTASA-N |
| XLogP | 6.57 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|