C29H50O6 — CID 70596445
ethyl 7-[(8R,9R)-8-[2-[2-(2-methylheptan-2-yl)-1,3-dioxolan-2-yl]ethenyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate (PubChem CID 70596445) has the molecular formula C29H50O6 and a molecular weight of 494.71 g/mol. Its IUPAC name is ethyl 7-[(8R,9R)-8-[2-[2-(2-methylheptan-2-yl)-1,3-dioxolan-2-yl]ethenyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate.
| Compound Name | ethyl 7-[(8R,9R)-8-[2-[2-(2-methylheptan-2-yl)-1,3-dioxolan-2-yl]ethenyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate |
|---|---|
| PubChem CID | 70596445 |
| Molecular Formula | C29H50O6 |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | ethyl 7-[(8R,9R)-8-[2-[2-(2-methylheptan-2-yl)-1,3-dioxolan-2-yl]ethenyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate |
| SMILES | CCCCCC(C)(C)C1(C=C[C@H]2CCC3(OCCO3)[C@@H]2CCCCCCC(=O)OCC)OCCO1 |
| InChI | InChI=1S/C29H50O6/c1-5-7-12-17-27(3,4)29(34-22-23-35-29)19-16-24-15-18-28(32-20-21-33-28)25(24)13-10-8-9-11-14-26(30)31-6-2/h16,19,24-25H,5-15,17-18,20-23H2,1-4H3/t24-,25-/m1/s1 |
| InChIKey | APFBYPFLHZNIJD-JWQCQUIFSA-N |
| XLogP | 6.57 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|