About 1-aminoethyl 4,5-dimethylthiophene-2-carboxylate
1-aminoethyl 4,5-dimethylthiophene-2-carboxylate (PubChem CID 70596483) has the molecular formula C9H13NO2S
and a molecular weight of 199.28 g/mol. Its IUPAC name is 1-aminoethyl 4,5-dimethylthiophene-2-carboxylate.
Molecular Properties
| Compound Name | 1-aminoethyl 4,5-dimethylthiophene-2-carboxylate |
| PubChem CID | 70596483 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 1-aminoethyl 4,5-dimethylthiophene-2-carboxylate |
| SMILES | Cc1cc(C(=O)OC(C)N)sc1C |
| InChI | InChI=1S/C9H13NO2S/c1-5-4-8(13-6(5)2)9(11)12-7(3)10/h4,7H,10H2,1-3H3 |
| InChIKey | MPPTXWSPUQPOBU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethyl 4,5-dimethylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethyl 4,5-dimethylthiophene-2-carboxylate?
The IUPAC name of 1-aminoethyl 4,5-dimethylthiophene-2-carboxylate (CID 70596483) is 1-aminoethyl 4,5-dimethylthiophene-2-carboxylate.
What is the SMILES notation for 1-aminoethyl 4,5-dimethylthiophene-2-carboxylate?
The canonical SMILES for 1-aminoethyl 4,5-dimethylthiophene-2-carboxylate is Cc1cc(C(=O)OC(C)N)sc1C.
What is the InChIKey of 1-aminoethyl 4,5-dimethylthiophene-2-carboxylate?
The InChIKey is MPPTXWSPUQPOBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c1-5-4-8(13-6(5)2)9(11)12-7(3)10/h4,7H,10H2,1-3H3.
What are the key properties of 1-aminoethyl 4,5-dimethylthiophene-2-carboxylate?
1-aminoethyl 4,5-dimethylthiophene-2-carboxylate has a molecular weight of 199.28 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethyl 4,5-dimethylthiophene-2-carboxylate is sourced from PubChem (CID 70596483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).