C15H13N — CID 70596555
1,2,3,4-tetrahydrophenanthrene-9-carbonitrile (PubChem CID 70596555) has the molecular formula C15H13N and a molecular weight of 207.28 g/mol. Its IUPAC name is 1,2,3,4-tetrahydrophenanthrene-9-carbonitrile.
| Compound Name | 1,2,3,4-tetrahydrophenanthrene-9-carbonitrile |
|---|---|
| PubChem CID | 70596555 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1,2,3,4-tetrahydrophenanthrene-9-carbonitrile |
| SMILES | N#Cc1cc2c(c3ccccc13)CCCC2 |
| InChI | InChI=1S/C15H13N/c16-10-12-9-11-5-1-2-6-13(11)15-8-4-3-7-14(12)15/h3-4,7-9H,1-2,5-6H2 |
| InChIKey | DTJFQULGVZOVTH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |