About 2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride
2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride (PubChem CID 70596663) has the molecular formula C15H14Cl2N2
and a molecular weight of 293.20 g/mol. Its IUPAC name is 2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride |
| PubChem CID | 70596663 |
| Molecular Formula | C15H14Cl2N2 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride |
| SMILES | Cl.ClC(/C=N/c1ccccc1)/C=N/c1ccccc1 |
| InChI | InChI=1S/C15H13ClN2.ClH/c16-13(11-17-14-7-3-1-4-8-14)12-18-15-9-5-2-6-10-15;/h1-13H;1H/b17-11+,18-12+; |
| InChIKey | XQVGFRDUAKLWFL-OYJDLGDISA-N |
| XLogP | 4.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride?
The IUPAC name of 2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride (CID 70596663) is 2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride.
What is the SMILES notation for 2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride?
The canonical SMILES for 2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride is Cl.ClC(/C=N/c1ccccc1)/C=N/c1ccccc1.
What is the InChIKey of 2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride?
The InChIKey is XQVGFRDUAKLWFL-OYJDLGDISA-N. The full InChI is InChI=1S/C15H13ClN2.ClH/c16-13(11-17-14-7-3-1-4-8-14)12-18-15-9-5-2-6-10-15;/h1-13H;1H/b17-11+,18-12+;.
What are the key properties of 2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride?
2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride has a molecular weight of 293.20 g/mol, XLogP of 4.82, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N'-diphenylpropane-1,3-diimine;hydrochloride is sourced from PubChem (CID 70596663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).