About [(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium
[(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium (PubChem CID 7059712) has the molecular formula C12H22NS+
and a molecular weight of 212.38 g/mol. Its IUPAC name is [(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium.
Molecular Properties
| Compound Name | [(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium |
| PubChem CID | 7059712 |
| Molecular Formula | C12H22NS+ |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | [(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium |
| SMILES | C[C@@H]([NH3+])C12C[C@@H]3C[C@@H](CC(S)(C3)C1)C2 |
| InChI | InChI=1S/C12H21NS/c1-8(13)11-3-9-2-10(4-11)6-12(14,5-9)7-11/h8-10,14H,2-7,13H2,1H3/p+1/t8-,9-,10+,11?,12?/m1/s1 |
| InChIKey | NASGBIMHXZIRHY-QZWZXBRZSA-O |
| XLogP | 1.89 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium?
The IUPAC name of [(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium (CID 7059712) is [(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium.
What is the SMILES notation for [(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium?
The canonical SMILES for [(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium is C[C@@H]([NH3+])C12C[C@@H]3C[C@@H](CC(S)(C3)C1)C2.
What is the InChIKey of [(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium?
The InChIKey is NASGBIMHXZIRHY-QZWZXBRZSA-O. The full InChI is InChI=1S/C12H21NS/c1-8(13)11-3-9-2-10(4-11)6-12(14,5-9)7-11/h8-10,14H,2-7,13H2,1H3/p+1/t8-,9-,10+,11?,12?/m1/s1.
What are the key properties of [(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium?
[(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium has a molecular weight of 212.38 g/mol, XLogP of 1.89, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-[(5S,7R)-3-sulfanyl-1-adamantyl]ethyl]azanium is sourced from PubChem (CID 7059712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).