C21H39ClO2 — CID 70597146
7-[(1S,2S)-2-[(E)-5-(chloromethyl)oct-1-enyl]cyclopentyl]heptane-1,1-diol (PubChem CID 70597146) has the molecular formula C21H39ClO2 and a molecular weight of 358.99 g/mol. Its IUPAC name is 7-[(1S,2S)-2-[(E)-5-(chloromethyl)oct-1-enyl]cyclopentyl]heptane-1,1-diol.
| Compound Name | 7-[(1S,2S)-2-[(E)-5-(chloromethyl)oct-1-enyl]cyclopentyl]heptane-1,1-diol |
|---|---|
| PubChem CID | 70597146 |
| Molecular Formula | C21H39ClO2 |
| Molecular Weight | 358.99 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 7-[(1S,2S)-2-[(E)-5-(chloromethyl)oct-1-enyl]cyclopentyl]heptane-1,1-diol |
| SMILES | CCCC(CCl)CC/C=C/[C@H]1CCC[C@@H]1CCCCCCC(O)O |
| InChI | InChI=1S/C21H39ClO2/c1-2-10-18(17-22)11-7-8-13-20-15-9-14-19(20)12-5-3-4-6-16-21(23)24/h8,13,18-21,23-24H,2-7,9-12,14-17H2,1H3/b13-8+/t18?,19-,20-/m0/s1 |
| InChIKey | BUZVZOIESMYJEA-RUGVKZLXSA-N |
| XLogP | 6.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.99 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|