C18H23NO4 — CID 70597219
6-[2-(dihydroxymethyl)but-2-enyl]-5-(3-methoxyphenyl)-1,2,3,4-tetrahydroazepin-7-one (PubChem CID 70597219) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 6-[2-(dihydroxymethyl)but-2-enyl]-5-(3-methoxyphenyl)-1,2,3,4-tetrahydroazepin-7-one.
| Compound Name | 6-[2-(dihydroxymethyl)but-2-enyl]-5-(3-methoxyphenyl)-1,2,3,4-tetrahydroazepin-7-one |
|---|---|
| PubChem CID | 70597219 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 6-[2-(dihydroxymethyl)but-2-enyl]-5-(3-methoxyphenyl)-1,2,3,4-tetrahydroazepin-7-one |
| SMILES | CC=C(CC1=C(c2cccc(OC)c2)CCCNC1=O)C(O)O |
| InChI | InChI=1S/C18H23NO4/c1-3-12(18(21)22)11-16-15(8-5-9-19-17(16)20)13-6-4-7-14(10-13)23-2/h3-4,6-7,10,18,21-22H,5,8-9,11H2,1-2H3,(H,19,20) |
| InChIKey | KWIZOGCVNWTVJW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|