C22H37ClO5 — CID 70597470
trans-(2R,3R)-3-[(4R)-4-(chloromethyl)oct-1-enyl]-2-(6,6,8-trihydroxy-7-oxooctyl)cyclopentan-1-one (PubChem CID 70597470) has the molecular formula C22H37ClO5 and a molecular weight of 416.99 g/mol. Its IUPAC name is trans-(2R,3R)-3-[(4R)-4-(chloromethyl)oct-1-enyl]-2-(6,6,8-trihydroxy-7-oxooctyl)cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-3-[(4R)-4-(chloromethyl)oct-1-enyl]-2-(6,6,8-trihydroxy-7-oxooctyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 70597470 |
| Molecular Formula | C22H37ClO5 |
| Molecular Weight | 416.99 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | trans-(2R,3R)-3-[(4R)-4-(chloromethyl)oct-1-enyl]-2-(6,6,8-trihydroxy-7-oxooctyl)cyclopentan-1-one |
| SMILES | CCCC[C@@H](CCl)CC=C[C@H]1CCC(=O)[C@@H]1CCCCCC(O)(O)C(=O)CO |
| InChI | InChI=1S/C22H37ClO5/c1-2-3-8-17(15-23)9-7-10-18-12-13-20(25)19(18)11-5-4-6-14-22(27,28)21(26)16-24/h7,10,17-19,24,27-28H,2-6,8-9,11-16H2,1H3/t17-,18+,19-/m1/s1 |
| InChIKey | LVZQBJNODHBYDH-CEXWTWQISA-N |
| XLogP | 3.77 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.99 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|