About 1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane
1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane (PubChem CID 70597681) has the molecular formula C22H27NO2
and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane.
Molecular Properties
| Compound Name | 1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane |
| PubChem CID | 70597681 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane |
| SMILES | CN1CCCC(Oc2ccc3c(c2)CCC(c2ccccc2)O3)CC1 |
| InChI | InChI=1S/C22H27NO2/c1-23-14-5-8-19(13-15-23)24-20-10-12-22-18(16-20)9-11-21(25-22)17-6-3-2-4-7-17/h2-4,6-7,10,12,16,19,21H,5,8-9,11,13-15H2,1H3 |
| InChIKey | GQSBHQGHYZZVMW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane?
The IUPAC name of 1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane (CID 70597681) is 1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane.
What is the SMILES notation for 1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane?
The canonical SMILES for 1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane is CN1CCCC(Oc2ccc3c(c2)CCC(c2ccccc2)O3)CC1.
What is the InChIKey of 1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane?
The InChIKey is GQSBHQGHYZZVMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO2/c1-23-14-5-8-19(13-15-23)24-20-10-12-22-18(16-20)9-11-21(25-22)17-6-3-2-4-7-17/h2-4,6-7,10,12,16,19,21H,5,8-9,11,13-15H2,1H3.
What are the key properties of 1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane?
1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane has a molecular weight of 337.46 g/mol, XLogP of 4.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]azepane is sourced from PubChem (CID 70597681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).