About stilbene;bis(2H-triazole)
stilbene;bis(2H-triazole) (PubChem CID 70597689) has the molecular formula C18H18N6
and a molecular weight of 318.38 g/mol. Its IUPAC name is stilbene;bis(2H-triazole).
Molecular Properties
| Compound Name | stilbene;bis(2H-triazole) |
| PubChem CID | 70597689 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | stilbene;bis(2H-triazole) |
| SMILES | C(=Cc1ccccc1)c1ccccc1.c1cn[nH]n1.c1cn[nH]n1 |
| InChI | InChI=1S/C14H12.2C2H3N3/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;2*1-2-4-5-3-1/h1-12H;2*1-2H,(H,3,4,5) |
| InChIKey | QMIUKRZVESRIRA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze stilbene;bis(2H-triazole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of stilbene;bis(2H-triazole)?
The IUPAC name of stilbene;bis(2H-triazole) (CID 70597689) is stilbene;bis(2H-triazole).
What is the SMILES notation for stilbene;bis(2H-triazole)?
The canonical SMILES for stilbene;bis(2H-triazole) is C(=Cc1ccccc1)c1ccccc1.c1cn[nH]n1.c1cn[nH]n1.
What is the InChIKey of stilbene;bis(2H-triazole)?
The InChIKey is QMIUKRZVESRIRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.2C2H3N3/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;2*1-2-4-5-3-1/h1-12H;2*1-2H,(H,3,4,5).
What are the key properties of stilbene;bis(2H-triazole)?
stilbene;bis(2H-triazole) has a molecular weight of 318.38 g/mol, XLogP of 3.47, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for stilbene;bis(2H-triazole) is sourced from PubChem (CID 70597689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).