C12H20O4 — CID 70597960
1-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]hexane-1,2-dione (PubChem CID 70597960) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]hexane-1,2-dione.
| Compound Name | 1-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]hexane-1,2-dione |
|---|---|
| PubChem CID | 70597960 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]hexane-1,2-dione |
| SMILES | CCCCC(=O)C(=O)[C@]1(C)COC(C)(C)O1 |
| InChI | InChI=1S/C12H20O4/c1-5-6-7-9(13)10(14)12(4)8-15-11(2,3)16-12/h5-8H2,1-4H3/t12-/m0/s1 |
| InChIKey | MRMRQJBDUCNEMH-LBPRGKRZSA-N |
| XLogP | 1.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|