C8H11N3O2S — CID 70598276
1-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]pyrrolidine-2,5-dione (PubChem CID 70598276) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is 1-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 70598276 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 1-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CNC1=NCCS1 |
| InChI | InChI=1S/C8H11N3O2S/c12-6-1-2-7(13)11(6)5-10-8-9-3-4-14-8/h1-5H2,(H,9,10) |
| InChIKey | QQIMZOLLUJZGIK-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|