C16H12N2O — CID 70598295
2,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,8,10,12,14,16-octaen-13-ol (PubChem CID 70598295) has the molecular formula C16H12N2O and a molecular weight of 248.29 g/mol. Its IUPAC name is 2,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,8,10,12,14,16-octaen-13-ol.
| Compound Name | 2,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,8,10,12,14,16-octaen-13-ol |
|---|---|
| PubChem CID | 70598295 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,8,10,12,14,16-octaen-13-ol |
| SMILES | OC1=C2C=CC=CC2c2nccn2-c2ccccc21 |
| InChI | InChI=1S/C16H12N2O/c19-15-11-5-1-2-6-12(11)16-17-9-10-18(16)14-8-4-3-7-13(14)15/h1-10,12,19H |
| InChIKey | FSINPUFKLYOLDQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |