C14H23N4O4+ — CID 7059853
1,3-dimethyl-5-(3-morpholin-4-ium-4-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7059853) has the molecular formula C14H23N4O4+ and a molecular weight of 311.36 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3-morpholin-4-ium-4-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-(3-morpholin-4-ium-4-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7059853 |
| Molecular Formula | C14H23N4O4+ |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1,3-dimethyl-5-(3-morpholin-4-ium-4-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(/C=N/CCC[NH+]2CCOCC2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C14H22N4O4/c1-16-12(19)11(13(20)17(2)14(16)21)10-15-4-3-5-18-6-8-22-9-7-18/h10-11H,3-9H2,1-2H3/p+1/b15-10+ |
| InChIKey | DCPFNEZETUPUOD-XNTDXEJSSA-O |
| XLogP | -1.97 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|