About (2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid
(2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid (PubChem CID 70598826) has the molecular formula C19H33N3O4
and a molecular weight of 367.49 g/mol. Its IUPAC name is (2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid.
Molecular Properties
| Compound Name | (2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid |
| PubChem CID | 70598826 |
| Molecular Formula | C19H33N3O4 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | (2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid |
| SMILES | CC(C)(N)COC(=O)CN.CCc1cc(C)cc(C)c1N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C13H19NO2.C6H14N2O2/c1-5-11-7-8(2)6-9(3)12(11)14-10(4)13(15)16;1-6(2,8)4-10-5(9)3-7/h6-7,10,14H,5H2,1-4H3,(H,15,16);3-4,7-8H2,1-2H3/t10-;/m0./s1 |
| InChIKey | XYHYWRIUQTYLNM-PPHPATTJSA-N |
| XLogP | 1.98 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid?
The IUPAC name of (2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid (CID 70598826) is (2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid.
What is the SMILES notation for (2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid?
The canonical SMILES for (2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid is CC(C)(N)COC(=O)CN.CCc1cc(C)cc(C)c1N[C@@H](C)C(=O)O.
What is the InChIKey of (2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid?
The InChIKey is XYHYWRIUQTYLNM-PPHPATTJSA-N. The full InChI is InChI=1S/C13H19NO2.C6H14N2O2/c1-5-11-7-8(2)6-9(3)12(11)14-10(4)13(15)16;1-6(2,8)4-10-5(9)3-7/h6-7,10,14H,5H2,1-4H3,(H,15,16);3-4,7-8H2,1-2H3/t10-;/m0./s1.
What are the key properties of (2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid?
(2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid has a molecular weight of 367.49 g/mol, XLogP of 1.98, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-methylpropyl) 2-aminoacetate;(2S)-2-(2-ethyl-4,6-dimethylanilino)propanoic acid is sourced from PubChem (CID 70598826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).