C19H24O3 — CID 70599050
9-(hydroxymethyl)-6,6-dimethyl-3-prop-2-enyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 70599050) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 9-(hydroxymethyl)-6,6-dimethyl-3-prop-2-enyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | 9-(hydroxymethyl)-6,6-dimethyl-3-prop-2-enyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 70599050 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 9-(hydroxymethyl)-6,6-dimethyl-3-prop-2-enyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | C=CCc1cc(O)c2c(c1)OC(C)(C)C1CCC(CO)=CC21 |
| InChI | InChI=1S/C19H24O3/c1-4-5-12-9-16(21)18-14-8-13(11-20)6-7-15(14)19(2,3)22-17(18)10-12/h4,8-10,14-15,20-21H,1,5-7,11H2,2-3H3 |
| InChIKey | AWHJIWJQZJLXAI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|