About 5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine
5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 70599152) has the molecular formula C6H9N5
and a molecular weight of 151.17 g/mol. Its IUPAC name is 5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | 5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 70599152 |
| Molecular Formula | C6H9N5 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | 5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | NC1=NCC(c2ccn[nH]2)N1 |
| InChI | InChI=1S/C6H9N5/c7-6-8-3-5(10-6)4-1-2-9-11-4/h1-2,5H,3H2,(H,9,11)(H3,7,8,10) |
| InChIKey | FCAQLVHPXOTEEX-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of 5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine (CID 70599152) is 5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for 5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for 5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine is NC1=NCC(c2ccn[nH]2)N1.
What is the InChIKey of 5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is FCAQLVHPXOTEEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5/c7-6-8-3-5(10-6)4-1-2-9-11-4/h1-2,5H,3H2,(H,9,11)(H3,7,8,10).
What are the key properties of 5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine?
5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 151.17 g/mol, XLogP of -0.63, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-pyrazol-5-yl)-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 70599152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).