C28H52N4O2 — CID 70599458
N,N'-bis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)but-2-enediamide (PubChem CID 70599458) has the molecular formula C28H52N4O2 and a molecular weight of 476.75 g/mol. Its IUPAC name is N,N'-bis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)but-2-enediamide.
| Compound Name | N,N'-bis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)but-2-enediamide |
|---|---|
| PubChem CID | 70599458 |
| Molecular Formula | C28H52N4O2 |
| Molecular Weight | 476.75 g/mol |
| Exact Mass | 476.41 |
| IUPAC Name | N,N'-bis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)but-2-enediamide |
| SMILES | CCC1(C)CC(NC(=O)C=CC(=O)NC2CC(C)(CC)NC(C)(CC)C2C)C(C)C(C)(CC)N1 |
| InChI | InChI=1S/C28H52N4O2/c1-11-25(7)17-21(19(5)27(9,13-3)31-25)29-23(33)15-16-24(34)30-22-18-26(8,12-2)32-28(10,14-4)20(22)6/h15-16,19-22,31-32H,11-14,17-18H2,1-10H3,(H,29,33)(H,30,34) |
| InChIKey | RUVKBBZZDQMSFC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.75 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|