C14H26N2 — CID 70599577
3-(4-pentyl-2,3,4,5-tetrahydroazepin-1-yl)prop-1-en-1-amine (PubChem CID 70599577) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 3-(4-pentyl-2,3,4,5-tetrahydroazepin-1-yl)prop-1-en-1-amine.
| Compound Name | 3-(4-pentyl-2,3,4,5-tetrahydroazepin-1-yl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 70599577 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 3-(4-pentyl-2,3,4,5-tetrahydroazepin-1-yl)prop-1-en-1-amine |
| SMILES | CCCCCC1CC=CN(CC=CN)CC1 |
| InChI | InChI=1S/C14H26N2/c1-2-3-4-7-14-8-5-11-16(13-9-14)12-6-10-15/h5-6,10-11,14H,2-4,7-9,12-13,15H2,1H3 |
| InChIKey | RJDVAVKHRQKNQI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|