About 10H-anthracen-9-one;1,3-thiazole
10H-anthracen-9-one;1,3-thiazole (PubChem CID 70599678) has the molecular formula C17H13NOS
and a molecular weight of 279.36 g/mol. Its IUPAC name is 10H-anthracen-9-one;1,3-thiazole.
Molecular Properties
| Compound Name | 10H-anthracen-9-one;1,3-thiazole |
| PubChem CID | 70599678 |
| Molecular Formula | C17H13NOS |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 10H-anthracen-9-one;1,3-thiazole |
| SMILES | O=C1c2ccccc2Cc2ccccc21.c1cscn1 |
| InChI | InChI=1S/C14H10O.C3H3NS/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14;1-2-5-3-4-1/h1-8H,9H2;1-3H |
| InChIKey | XWZCLBQARWZKFP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10H-anthracen-9-one;1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-anthracen-9-one;1,3-thiazole?
The IUPAC name of 10H-anthracen-9-one;1,3-thiazole (CID 70599678) is 10H-anthracen-9-one;1,3-thiazole.
What is the SMILES notation for 10H-anthracen-9-one;1,3-thiazole?
The canonical SMILES for 10H-anthracen-9-one;1,3-thiazole is O=C1c2ccccc2Cc2ccccc21.c1cscn1.
What is the InChIKey of 10H-anthracen-9-one;1,3-thiazole?
The InChIKey is XWZCLBQARWZKFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O.C3H3NS/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14;1-2-5-3-4-1/h1-8H,9H2;1-3H.
What are the key properties of 10H-anthracen-9-one;1,3-thiazole?
10H-anthracen-9-one;1,3-thiazole has a molecular weight of 279.36 g/mol, XLogP of 3.96, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-anthracen-9-one;1,3-thiazole is sourced from PubChem (CID 70599678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).