C15H28O7P2 — CID 706
phosphono 3,7,11-trimethyldodeca-2,6,10-trienyl hydrogen phosphate (PubChem CID 706) has the molecular formula C15H28O7P2 and a molecular weight of 382.33 g/mol. Its IUPAC name is phosphono 3,7,11-trimethyldodeca-2,6,10-trienyl hydrogen phosphate.
| Compound Name | phosphono 3,7,11-trimethyldodeca-2,6,10-trienyl hydrogen phosphate |
|---|---|
| PubChem CID | 706 |
| Molecular Formula | C15H28O7P2 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | phosphono 3,7,11-trimethyldodeca-2,6,10-trienyl hydrogen phosphate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCOP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C15H28O7P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-21-24(19,20)22-23(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,19,20)(H2,16,17,18) |
| InChIKey | VWFJDQUYCIWHTN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|