About 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine
1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine (PubChem CID 70600222) has the molecular formula C21H35NO2
and a molecular weight of 333.52 g/mol. Its IUPAC name is 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine.
Molecular Properties
| Compound Name | 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine |
| PubChem CID | 70600222 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine |
| SMILES | COC1(OC)CCN(CC(C)Cc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H35NO2/c1-17(15-18-7-9-19(10-8-18)20(2,3)4)16-22-13-11-21(23-5,24-6)12-14-22/h7-10,17H,11-16H2,1-6H3 |
| InChIKey | UFBGYKZGENPIQZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine?
The IUPAC name of 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine (CID 70600222) is 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine.
What is the SMILES notation for 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine?
The canonical SMILES for 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine is COC1(OC)CCN(CC(C)Cc2ccc(C(C)(C)C)cc2)CC1.
What is the InChIKey of 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine?
The InChIKey is UFBGYKZGENPIQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35NO2/c1-17(15-18-7-9-19(10-8-18)20(2,3)4)16-22-13-11-21(23-5,24-6)12-14-22/h7-10,17H,11-16H2,1-6H3.
What are the key properties of 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine?
1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine has a molecular weight of 333.52 g/mol, XLogP of 4.25, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-4,4-dimethoxypiperidine is sourced from PubChem (CID 70600222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).