About thiopyrano[3,2-c]pyrazole
thiopyrano[3,2-c]pyrazole (PubChem CID 70600641) has the molecular formula C6H4N2S
and a molecular weight of 136.18 g/mol. Its IUPAC name is thiopyrano[3,2-c]pyrazole.
Molecular Properties
| Compound Name | thiopyrano[3,2-c]pyrazole |
| PubChem CID | 70600641 |
| Molecular Formula | C6H4N2S |
| Molecular Weight | 136.18 g/mol |
| Exact Mass | 136.01 |
| IUPAC Name | thiopyrano[3,2-c]pyrazole |
| SMILES | c1csc2cnnc-2c1 |
| InChI | InChI=1S/C6H4N2S/c1-2-5-6(9-3-1)4-7-8-5/h1-4H |
| InChIKey | BWOHYFAVHCXVGN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thiopyrano[3,2-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiopyrano[3,2-c]pyrazole?
The IUPAC name of thiopyrano[3,2-c]pyrazole (CID 70600641) is thiopyrano[3,2-c]pyrazole.
What is the SMILES notation for thiopyrano[3,2-c]pyrazole?
The canonical SMILES for thiopyrano[3,2-c]pyrazole is c1csc2cnnc-2c1.
What is the InChIKey of thiopyrano[3,2-c]pyrazole?
The InChIKey is BWOHYFAVHCXVGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2S/c1-2-5-6(9-3-1)4-7-8-5/h1-4H.
What are the key properties of thiopyrano[3,2-c]pyrazole?
thiopyrano[3,2-c]pyrazole has a molecular weight of 136.18 g/mol, XLogP of 1.64, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiopyrano[3,2-c]pyrazole is sourced from PubChem (CID 70600641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).