About N,N-dibutylbutan-1-amine;phenylmethanol
N,N-dibutylbutan-1-amine;phenylmethanol (PubChem CID 70600701) has the molecular formula C19H35NO
and a molecular weight of 293.49 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;phenylmethanol.
Molecular Properties
| Compound Name | N,N-dibutylbutan-1-amine;phenylmethanol |
| PubChem CID | 70600701 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.49 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | N,N-dibutylbutan-1-amine;phenylmethanol |
| SMILES | CCCCN(CCCC)CCCC.OCc1ccccc1 |
| InChI | InChI=1S/C12H27N.C7H8O/c1-4-7-10-13(11-8-5-2)12-9-6-3;8-6-7-4-2-1-3-5-7/h4-12H2,1-3H3;1-5,8H,6H2 |
| InChIKey | MOKRMVUWMLPGEC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dibutylbutan-1-amine;phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutylbutan-1-amine;phenylmethanol?
The IUPAC name of N,N-dibutylbutan-1-amine;phenylmethanol (CID 70600701) is N,N-dibutylbutan-1-amine;phenylmethanol.
What is the SMILES notation for N,N-dibutylbutan-1-amine;phenylmethanol?
The canonical SMILES for N,N-dibutylbutan-1-amine;phenylmethanol is CCCCN(CCCC)CCCC.OCc1ccccc1.
What is the InChIKey of N,N-dibutylbutan-1-amine;phenylmethanol?
The InChIKey is MOKRMVUWMLPGEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.C7H8O/c1-4-7-10-13(11-8-5-2)12-9-6-3;8-6-7-4-2-1-3-5-7/h4-12H2,1-3H3;1-5,8H,6H2.
What are the key properties of N,N-dibutylbutan-1-amine;phenylmethanol?
N,N-dibutylbutan-1-amine;phenylmethanol has a molecular weight of 293.49 g/mol, XLogP of 4.87, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutylbutan-1-amine;phenylmethanol is sourced from PubChem (CID 70600701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).