About benzene;benzene-1,3-diol;3H-2-benzofuran-1-one
benzene;benzene-1,3-diol;3H-2-benzofuran-1-one (PubChem CID 70600713) has the molecular formula C20H18O4
and a molecular weight of 322.36 g/mol. Its IUPAC name is benzene;benzene-1,3-diol;3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | benzene;benzene-1,3-diol;3H-2-benzofuran-1-one |
| PubChem CID | 70600713 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | benzene;benzene-1,3-diol;3H-2-benzofuran-1-one |
| SMILES | O=C1OCc2ccccc21.Oc1cccc(O)c1.c1ccccc1 |
| InChI | InChI=1S/C8H6O2.C6H6O2.C6H6/c9-8-7-4-2-1-3-6(7)5-10-8;7-5-2-1-3-6(8)4-5;1-2-4-6-5-3-1/h1-4H,5H2;1-4,7-8H;1-6H |
| InChIKey | JGAPEIKKAQMGRB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzene;benzene-1,3-diol;3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;benzene-1,3-diol;3H-2-benzofuran-1-one?
The IUPAC name of benzene;benzene-1,3-diol;3H-2-benzofuran-1-one (CID 70600713) is benzene;benzene-1,3-diol;3H-2-benzofuran-1-one.
What is the SMILES notation for benzene;benzene-1,3-diol;3H-2-benzofuran-1-one?
The canonical SMILES for benzene;benzene-1,3-diol;3H-2-benzofuran-1-one is O=C1OCc2ccccc21.Oc1cccc(O)c1.c1ccccc1.
What is the InChIKey of benzene;benzene-1,3-diol;3H-2-benzofuran-1-one?
The InChIKey is JGAPEIKKAQMGRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2.C6H6O2.C6H6/c9-8-7-4-2-1-3-6(7)5-10-8;7-5-2-1-3-6(8)4-5;1-2-4-6-5-3-1/h1-4H,5H2;1-4,7-8H;1-6H.
What are the key properties of benzene;benzene-1,3-diol;3H-2-benzofuran-1-one?
benzene;benzene-1,3-diol;3H-2-benzofuran-1-one has a molecular weight of 322.36 g/mol, XLogP of 4.14, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;benzene-1,3-diol;3H-2-benzofuran-1-one is sourced from PubChem (CID 70600713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).