C20H29NO6 — CID 70600783
(E)-but-2-enedioic acid;3-[dimethylamino-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]methyl]phenol (PubChem CID 70600783) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-[dimethylamino-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]methyl]phenol.
| Compound Name | (E)-but-2-enedioic acid;3-[dimethylamino-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]methyl]phenol |
|---|---|
| PubChem CID | 70600783 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (E)-but-2-enedioic acid;3-[dimethylamino-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]methyl]phenol |
| SMILES | CN(C)C(c1cccc(O)c1)[C@H]1CCCC[C@@]1(C)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H25NO2.C4H4O4/c1-16(19)10-5-4-9-14(16)15(17(2)3)12-7-6-8-13(18)11-12;5-3(6)1-2-4(7)8/h6-8,11,14-15,18-19H,4-5,9-10H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t14-,15?,16-;/m1./s1 |
| InChIKey | VKXQNMIWDJBUEF-FHZXAYHRSA-N |
| XLogP | 2.65 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|