C19H16Cl4O6 — CID 70600870
2,4-bis(3,5-dichloro-4-hydroxyphenyl)-3,3-dimethylpentanedioic acid (PubChem CID 70600870) has the molecular formula C19H16Cl4O6 and a molecular weight of 482.14 g/mol. Its IUPAC name is 2,4-bis(3,5-dichloro-4-hydroxyphenyl)-3,3-dimethylpentanedioic acid.
| Compound Name | 2,4-bis(3,5-dichloro-4-hydroxyphenyl)-3,3-dimethylpentanedioic acid |
|---|---|
| PubChem CID | 70600870 |
| Molecular Formula | C19H16Cl4O6 |
| Molecular Weight | 482.14 g/mol |
| Exact Mass | 479.97 |
| IUPAC Name | 2,4-bis(3,5-dichloro-4-hydroxyphenyl)-3,3-dimethylpentanedioic acid |
| SMILES | CC(C)(C(C(=O)O)c1cc(Cl)c(O)c(Cl)c1)C(C(=O)O)c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C19H16Cl4O6/c1-19(2,13(17(26)27)7-3-9(20)15(24)10(21)4-7)14(18(28)29)8-5-11(22)16(25)12(23)6-8/h3-6,13-14,24-25H,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | BWKQWDCCNVMUNI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.14 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |