About 5-methylanthracene-1,4,9,10-tetrone
5-methylanthracene-1,4,9,10-tetrone (PubChem CID 70601050) has the molecular formula C15H8O4
and a molecular weight of 252.22 g/mol. Its IUPAC name is 5-methylanthracene-1,4,9,10-tetrone.
Molecular Properties
| Compound Name | 5-methylanthracene-1,4,9,10-tetrone |
| PubChem CID | 70601050 |
| Molecular Formula | C15H8O4 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 5-methylanthracene-1,4,9,10-tetrone |
| SMILES | Cc1cccc2c(=O)c3c(=O)ccc(=O)c=3c(=O)c12 |
| InChI | InChI=1S/C15H8O4/c1-7-3-2-4-8-11(7)15(19)13-10(17)6-5-9(16)12(13)14(8)18/h2-6H,1H3 |
| InChIKey | XUCYXSUZXHWLEY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 5-methylanthracene-1,4,9,10-tetrone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylanthracene-1,4,9,10-tetrone?
The IUPAC name of 5-methylanthracene-1,4,9,10-tetrone (CID 70601050) is 5-methylanthracene-1,4,9,10-tetrone.
What is the SMILES notation for 5-methylanthracene-1,4,9,10-tetrone?
The canonical SMILES for 5-methylanthracene-1,4,9,10-tetrone is Cc1cccc2c(=O)c3c(=O)ccc(=O)c=3c(=O)c12.
What is the InChIKey of 5-methylanthracene-1,4,9,10-tetrone?
The InChIKey is XUCYXSUZXHWLEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8O4/c1-7-3-2-4-8-11(7)15(19)13-10(17)6-5-9(16)12(13)14(8)18/h2-6H,1H3.
What are the key properties of 5-methylanthracene-1,4,9,10-tetrone?
5-methylanthracene-1,4,9,10-tetrone has a molecular weight of 252.22 g/mol, XLogP of 0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylanthracene-1,4,9,10-tetrone is sourced from PubChem (CID 70601050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).