C25H18N2O2 — CID 7060112
2-[(3S,4S)-3,4-diphenyl-3,4-dihydropyridazin-6-yl]-3-hydroxyinden-1-one (PubChem CID 7060112) has the molecular formula C25H18N2O2 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-[(3S,4S)-3,4-diphenyl-3,4-dihydropyridazin-6-yl]-3-hydroxyinden-1-one.
| Compound Name | 2-[(3S,4S)-3,4-diphenyl-3,4-dihydropyridazin-6-yl]-3-hydroxyinden-1-one |
|---|---|
| PubChem CID | 7060112 |
| Molecular Formula | C25H18N2O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-[(3S,4S)-3,4-diphenyl-3,4-dihydropyridazin-6-yl]-3-hydroxyinden-1-one |
| SMILES | O=C1C(C2=C[C@@H](c3ccccc3)[C@@H](c3ccccc3)N=N2)=C(O)c2ccccc21 |
| InChI | InChI=1S/C25H18N2O2/c28-24-18-13-7-8-14-19(18)25(29)22(24)21-15-20(16-9-3-1-4-10-16)23(27-26-21)17-11-5-2-6-12-17/h1-15,20,23,28H/t20-,23+/m0/s1 |
| InChIKey | VSAUJSUYATWWSJ-NZQKXSOJSA-N |
| XLogP | 6.03 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'} |
|---|