About (1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol
(1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol (PubChem CID 70601267) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is (1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol.
Molecular Properties
| Compound Name | (1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol |
| PubChem CID | 70601267 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol |
| SMILES | CNCCC1=CC[C@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C9H17NO2/c1-10-5-4-7-2-3-8(11)9(12)6-7/h2,8-12H,3-6H2,1H3/t8-,9+/m0/s1 |
| InChIKey | QDQCXUZZSYUELE-DTWKUNHWSA-N |
| XLogP | 0.04 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol?
The IUPAC name of (1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol (CID 70601267) is (1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol.
What is the SMILES notation for (1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol?
The canonical SMILES for (1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol is CNCCC1=CC[C@H](O)[C@H](O)C1.
What is the InChIKey of (1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol?
The InChIKey is QDQCXUZZSYUELE-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H17NO2/c1-10-5-4-7-2-3-8(11)9(12)6-7/h2,8-12H,3-6H2,1H3/t8-,9+/m0/s1.
What are the key properties of (1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol?
(1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol has a molecular weight of 171.24 g/mol, XLogP of 0.04, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-4-[2-(methylamino)ethyl]cyclohex-4-ene-1,2-diol is sourced from PubChem (CID 70601267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).