About N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine
N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine (PubChem CID 70601286) has the molecular formula C17H29N
and a molecular weight of 247.43 g/mol. Its IUPAC name is N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine.
Molecular Properties
| Compound Name | N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine |
| PubChem CID | 70601286 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine |
| SMILES | C=CCCCC=CCC1(/N=C/CC)CCCCC1 |
| InChI | InChI=1S/C17H29N/c1-3-5-6-7-8-10-13-17(18-16-4-2)14-11-9-12-15-17/h3,8,10,16H,1,4-7,9,11-15H2,2H3/b10-8?,18-16+ |
| InChIKey | XZWWDDBFRSHHCW-AELUEVPRSA-N |
| XLogP | 5.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine?
The IUPAC name of N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine (CID 70601286) is N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine.
What is the SMILES notation for N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine?
The canonical SMILES for N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine is C=CCCCC=CCC1(/N=C/CC)CCCCC1.
What is the InChIKey of N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine?
The InChIKey is XZWWDDBFRSHHCW-AELUEVPRSA-N. The full InChI is InChI=1S/C17H29N/c1-3-5-6-7-8-10-13-17(18-16-4-2)14-11-9-12-15-17/h3,8,10,16H,1,4-7,9,11-15H2,2H3/b10-8?,18-16+.
What are the key properties of N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine?
N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine has a molecular weight of 247.43 g/mol, XLogP of 5.47, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-octa-2,7-dienylcyclohexyl)propan-1-imine is sourced from PubChem (CID 70601286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).