About 2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide
2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide (PubChem CID 70601324) has the molecular formula C6H8Br2N2O2
and a molecular weight of 299.95 g/mol. Its IUPAC name is 2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide.
Molecular Properties
| Compound Name | 2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide |
| PubChem CID | 70601324 |
| Molecular Formula | C6H8Br2N2O2 |
| Molecular Weight | 299.95 g/mol |
| Exact Mass | 297.90 |
| IUPAC Name | 2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide |
| SMILES | Br.Br.NC1=C(N)C(=O)C=CC1=O |
| InChI | InChI=1S/C6H6N2O2.2BrH/c7-5-3(9)1-2-4(10)6(5)8;;/h1-2H,7-8H2;2*1H |
| InChIKey | WGDKFIBIYTWHRY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.95 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide?
The IUPAC name of 2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide (CID 70601324) is 2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide.
What is the SMILES notation for 2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide?
The canonical SMILES for 2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide is Br.Br.NC1=C(N)C(=O)C=CC1=O.
What is the InChIKey of 2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide?
The InChIKey is WGDKFIBIYTWHRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.2BrH/c7-5-3(9)1-2-4(10)6(5)8;;/h1-2H,7-8H2;2*1H.
What are the key properties of 2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide?
2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide has a molecular weight of 299.95 g/mol, XLogP of -0.02, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diaminocyclohexa-2,5-diene-1,4-dione;dihydrobromide is sourced from PubChem (CID 70601324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).