C28H52O4Si — CID 70601329
7-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloctyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70601329) has the molecular formula C28H52O4Si and a molecular weight of 480.81 g/mol. Its IUPAC name is 7-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloctyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloctyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70601329 |
| Molecular Formula | C28H52O4Si |
| Molecular Weight | 480.81 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | 7-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloctyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(C)(C)C(CCC1CCC(=O)C1CC=CCCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H52O4Si/c1-9-10-21-28(5,6)25(32-33(7,8)27(2,3)4)20-18-22-17-19-24(29)23(22)15-13-11-12-14-16-26(30)31/h11,13,22-23,25H,9-10,12,14-21H2,1-8H3,(H,30,31) |
| InChIKey | WYDYRTTUEXWZKH-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.81 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|