About 2-phenyl-1,3-dioxonane
2-phenyl-1,3-dioxonane (PubChem CID 70602118) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-phenyl-1,3-dioxonane.
Molecular Properties
| Compound Name | 2-phenyl-1,3-dioxonane |
| PubChem CID | 70602118 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-phenyl-1,3-dioxonane |
| SMILES | c1ccc(C2OCCCCCCO2)cc1 |
| InChI | InChI=1S/C13H18O2/c1-2-7-11-15-13(14-10-6-1)12-8-4-3-5-9-12/h3-5,8-9,13H,1-2,6-7,10-11H2 |
| InChIKey | UMLGANCDFPCCTR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-1,3-dioxonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,3-dioxonane?
The IUPAC name of 2-phenyl-1,3-dioxonane (CID 70602118) is 2-phenyl-1,3-dioxonane.
What is the SMILES notation for 2-phenyl-1,3-dioxonane?
The canonical SMILES for 2-phenyl-1,3-dioxonane is c1ccc(C2OCCCCCCO2)cc1.
What is the InChIKey of 2-phenyl-1,3-dioxonane?
The InChIKey is UMLGANCDFPCCTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-2-7-11-15-13(14-10-6-1)12-8-4-3-5-9-12/h3-5,8-9,13H,1-2,6-7,10-11H2.
What are the key properties of 2-phenyl-1,3-dioxonane?
2-phenyl-1,3-dioxonane has a molecular weight of 206.29 g/mol, XLogP of 3.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,3-dioxonane is sourced from PubChem (CID 70602118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).