C21H25N3O6S — CID 70602460
(2S,5R)-6-[[5-(2,6-dimethoxyphenyl)-3-methyl-1,2-oxazol-4-yl]amino]-3,3,6-trimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 70602460) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is (2S,5R)-6-[[5-(2,6-dimethoxyphenyl)-3-methyl-1,2-oxazol-4-yl]amino]-3,3,6-trimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R)-6-[[5-(2,6-dimethoxyphenyl)-3-methyl-1,2-oxazol-4-yl]amino]-3,3,6-trimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 70602460 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | (2S,5R)-6-[[5-(2,6-dimethoxyphenyl)-3-methyl-1,2-oxazol-4-yl]amino]-3,3,6-trimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | COc1cccc(OC)c1-c1onc(C)c1NC1(C)C(=O)N2[C@@H](C(=O)O)C(C)(C)S[C@@H]21 |
| InChI | InChI=1S/C21H25N3O6S/c1-10-14(15(30-23-10)13-11(28-5)8-7-9-12(13)29-6)22-21(4)18(27)24-16(17(25)26)20(2,3)31-19(21)24/h7-9,16,19,22H,1-6H3,(H,25,26)/t16-,19+,21?/m0/s1 |
| InChIKey | ALRZUCWUUBNTOW-FZWXSHBKSA-N |
| XLogP | 2.98 |
| TPSA | 114.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |