C20H36O4 — CID 70602908
9-[(5R)-5-(2-hydroxyethyl)-2-methyl-3,8-dioxabicyclo[3.2.1]octan-2-yl]-2,6-dimethylnon-2-en-5-ol (PubChem CID 70602908) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is 9-[(5R)-5-(2-hydroxyethyl)-2-methyl-3,8-dioxabicyclo[3.2.1]octan-2-yl]-2,6-dimethylnon-2-en-5-ol.
| Compound Name | 9-[(5R)-5-(2-hydroxyethyl)-2-methyl-3,8-dioxabicyclo[3.2.1]octan-2-yl]-2,6-dimethylnon-2-en-5-ol |
|---|---|
| PubChem CID | 70602908 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 9-[(5R)-5-(2-hydroxyethyl)-2-methyl-3,8-dioxabicyclo[3.2.1]octan-2-yl]-2,6-dimethylnon-2-en-5-ol |
| SMILES | CC(C)=CCC(O)C(C)CCCC1(C)OC[C@]2(CCO)CCC1O2 |
| InChI | InChI=1S/C20H36O4/c1-15(2)7-8-17(22)16(3)6-5-10-19(4)18-9-11-20(24-18,12-13-21)14-23-19/h7,16-18,21-22H,5-6,8-14H2,1-4H3/t16?,17?,18?,19?,20-/m1/s1 |
| InChIKey | NVOIVNCGPIYQLV-ZWQJFZRQSA-N |
| XLogP | 3.60 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|