C18H28N2O2 — CID 70602916
N-(2,6-diethylphenyl)-N'-(5,5-dimethyl-1,3-dioxan-2-yl)-N-methylmethanimidamide (PubChem CID 70602916) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-N'-(5,5-dimethyl-1,3-dioxan-2-yl)-N-methylmethanimidamide.
| Compound Name | N-(2,6-diethylphenyl)-N'-(5,5-dimethyl-1,3-dioxan-2-yl)-N-methylmethanimidamide |
|---|---|
| PubChem CID | 70602916 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | N-(2,6-diethylphenyl)-N'-(5,5-dimethyl-1,3-dioxan-2-yl)-N-methylmethanimidamide |
| SMILES | CCc1cccc(CC)c1N(C)C=NC1OCC(C)(C)CO1 |
| InChI | InChI=1S/C18H28N2O2/c1-6-14-9-8-10-15(7-2)16(14)20(5)13-19-17-21-11-18(3,4)12-22-17/h8-10,13,17H,6-7,11-12H2,1-5H3 |
| InChIKey | YZFKFTLJKDXPQR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|