C25H36O5S — CID 70603622
cis-methyl (2R,3R)-3-(1-ethoxyethoxy)-5-oxo-2-[(E)-8-phenylsulfanyloct-2-enyl]cyclopentane-1-carboxylate (PubChem CID 70603622) has the molecular formula C25H36O5S and a molecular weight of 448.63 g/mol. Its IUPAC name is cis-methyl (2R,3R)-3-(1-ethoxyethoxy)-5-oxo-2-[(E)-8-phenylsulfanyloct-2-enyl]cyclopentane-1-carboxylate.
| Compound Name | cis-methyl (2R,3R)-3-(1-ethoxyethoxy)-5-oxo-2-[(E)-8-phenylsulfanyloct-2-enyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 70603622 |
| Molecular Formula | C25H36O5S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | cis-methyl (2R,3R)-3-(1-ethoxyethoxy)-5-oxo-2-[(E)-8-phenylsulfanyloct-2-enyl]cyclopentane-1-carboxylate |
| SMILES | CCOC(C)O[C@@H]1CC(=O)C(C(=O)OC)[C@H]1C/C=C/CCCCCSc1ccccc1 |
| InChI | InChI=1S/C25H36O5S/c1-4-29-19(2)30-23-18-22(26)24(25(27)28-3)21(23)16-12-7-5-6-8-13-17-31-20-14-10-9-11-15-20/h7,9-12,14-15,19,21,23-24H,4-6,8,13,16-18H2,1-3H3/b12-7+/t19?,21-,23+,24?/m0/s1 |
| InChIKey | HQJNXYOKJQNMNT-GRTPGILSSA-N |
| XLogP | 5.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|